C16H25FN2O3S — CID 135186536
5-amino-N-[1-(4-fluoro-3-prop-2-enoxyphenyl)ethyl]pentane-1-sulfonamide (PubChem CID 135186536) has the molecular formula C16H25FN2O3S and a molecular weight of 344.45 g/mol. Its IUPAC name is 5-amino-N-[1-(4-fluoro-3-prop-2-enoxyphenyl)ethyl]pentane-1-sulfonamide.
| Compound Name | 5-amino-N-[1-(4-fluoro-3-prop-2-enoxyphenyl)ethyl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 135186536 |
| Molecular Formula | C16H25FN2O3S |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 5-amino-N-[1-(4-fluoro-3-prop-2-enoxyphenyl)ethyl]pentane-1-sulfonamide |
| SMILES | C=CCOc1cc(C(C)NS(=O)(=O)CCCCCN)ccc1F |
| InChI | InChI=1S/C16H25FN2O3S/c1-3-10-22-16-12-14(7-8-15(16)17)13(2)19-23(20,21)11-6-4-5-9-18/h3,7-8,12-13,19H,1,4-6,9-11,18H2,2H3 |
| InChIKey | ZGEYQIUCYNXUHG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|