C18H29FN2O3S — CID 134541012
5-amino-N-[1-[3-(2-cyclopropylethoxy)-4-fluorophenyl]ethyl]pentane-1-sulfonamide (PubChem CID 134541012) has the molecular formula C18H29FN2O3S and a molecular weight of 372.51 g/mol. Its IUPAC name is 5-amino-N-[1-[3-(2-cyclopropylethoxy)-4-fluorophenyl]ethyl]pentane-1-sulfonamide.
| Compound Name | 5-amino-N-[1-[3-(2-cyclopropylethoxy)-4-fluorophenyl]ethyl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 134541012 |
| Molecular Formula | C18H29FN2O3S |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 5-amino-N-[1-[3-(2-cyclopropylethoxy)-4-fluorophenyl]ethyl]pentane-1-sulfonamide |
| SMILES | CC(NS(=O)(=O)CCCCCN)c1ccc(F)c(OCCC2CC2)c1 |
| InChI | InChI=1S/C18H29FN2O3S/c1-14(21-25(22,23)12-4-2-3-10-20)16-7-8-17(19)18(13-16)24-11-9-15-5-6-15/h7-8,13-15,21H,2-6,9-12,20H2,1H3 |
| InChIKey | SWZCYUOLFCLKIX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|