C16H24F3NO3S — CID 135198061
N-[(1R)-1-[3-(2,2-difluoroethoxy)-4-fluorophenyl]ethyl]hexane-1-sulfonamide (PubChem CID 135198061) has the molecular formula C16H24F3NO3S and a molecular weight of 367.43 g/mol. Its IUPAC name is N-[(1R)-1-[3-(2,2-difluoroethoxy)-4-fluorophenyl]ethyl]hexane-1-sulfonamide.
| Compound Name | N-[(1R)-1-[3-(2,2-difluoroethoxy)-4-fluorophenyl]ethyl]hexane-1-sulfonamide |
|---|---|
| PubChem CID | 135198061 |
| Molecular Formula | C16H24F3NO3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-[(1R)-1-[3-(2,2-difluoroethoxy)-4-fluorophenyl]ethyl]hexane-1-sulfonamide |
| SMILES | CCCCCCS(=O)(=O)N[C@H](C)c1ccc(F)c(OCC(F)F)c1 |
| InChI | InChI=1S/C16H24F3NO3S/c1-3-4-5-6-9-24(21,22)20-12(2)13-7-8-14(17)15(10-13)23-11-16(18)19/h7-8,10,12,16,20H,3-6,9,11H2,1-2H3/t12-/m1/s1 |
| InChIKey | HVFARSAGAUSVHM-GFCCVEGCSA-N |
| XLogP | 4.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|