C16H24FNO4S — CID 135186533
N-[(1R)-1-[4-fluoro-3-[(2R)-3-hydroxy-2-methylpropoxy]phenyl]ethyl]but-3-ene-1-sulfonamide (PubChem CID 135186533) has the molecular formula C16H24FNO4S and a molecular weight of 345.44 g/mol. Its IUPAC name is N-[(1R)-1-[4-fluoro-3-[(2R)-3-hydroxy-2-methylpropoxy]phenyl]ethyl]but-3-ene-1-sulfonamide.
| Compound Name | N-[(1R)-1-[4-fluoro-3-[(2R)-3-hydroxy-2-methylpropoxy]phenyl]ethyl]but-3-ene-1-sulfonamide |
|---|---|
| PubChem CID | 135186533 |
| Molecular Formula | C16H24FNO4S |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | N-[(1R)-1-[4-fluoro-3-[(2R)-3-hydroxy-2-methylpropoxy]phenyl]ethyl]but-3-ene-1-sulfonamide |
| SMILES | C=CCCS(=O)(=O)N[C@H](C)c1ccc(F)c(OC[C@H](C)CO)c1 |
| InChI | InChI=1S/C16H24FNO4S/c1-4-5-8-23(20,21)18-13(3)14-6-7-15(17)16(9-14)22-11-12(2)10-19/h4,6-7,9,12-13,18-19H,1,5,8,10-11H2,2-3H3/t12-,13-/m1/s1 |
| InChIKey | RGGWCAFCGZACTQ-CHWSQXEVSA-N |
| XLogP | 2.39 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|