C24H29FN2O5S — CID 134544090
5-(1,3-dioxoisoindol-2-yl)-N-[1-(4-fluoro-3-propoxyphenyl)ethyl]pentane-1-sulfonamide (PubChem CID 134544090) has the molecular formula C24H29FN2O5S and a molecular weight of 476.57 g/mol. Its IUPAC name is 5-(1,3-dioxoisoindol-2-yl)-N-[1-(4-fluoro-3-propoxyphenyl)ethyl]pentane-1-sulfonamide.
| Compound Name | 5-(1,3-dioxoisoindol-2-yl)-N-[1-(4-fluoro-3-propoxyphenyl)ethyl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 134544090 |
| Molecular Formula | C24H29FN2O5S |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 5-(1,3-dioxoisoindol-2-yl)-N-[1-(4-fluoro-3-propoxyphenyl)ethyl]pentane-1-sulfonamide |
| SMILES | CCCOc1cc(C(C)NS(=O)(=O)CCCCCN2C(=O)c3ccccc3C2=O)ccc1F |
| InChI | InChI=1S/C24H29FN2O5S/c1-3-14-32-22-16-18(11-12-21(22)25)17(2)26-33(30,31)15-8-4-7-13-27-23(28)19-9-5-6-10-20(19)24(27)29/h5-6,9-12,16-17,26H,3-4,7-8,13-15H2,1-2H3 |
| InChIKey | AGBVBOYRSHTDOT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|