C30H41FN2O2S — CID 142361270
3-cyclobutylidene-2-[5-[[(1S)-1-(4-fluoro-3-propoxyphenyl)ethyl]amino]sulfanylpentyl]isoindol-1-one;ethane (PubChem CID 142361270) has the molecular formula C30H41FN2O2S and a molecular weight of 512.74 g/mol. Its IUPAC name is 3-cyclobutylidene-2-[5-[[(1S)-1-(4-fluoro-3-propoxyphenyl)ethyl]amino]sulfanylpentyl]isoindol-1-one;ethane.
| Compound Name | 3-cyclobutylidene-2-[5-[[(1S)-1-(4-fluoro-3-propoxyphenyl)ethyl]amino]sulfanylpentyl]isoindol-1-one;ethane |
|---|---|
| PubChem CID | 142361270 |
| Molecular Formula | C30H41FN2O2S |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | 3-cyclobutylidene-2-[5-[[(1S)-1-(4-fluoro-3-propoxyphenyl)ethyl]amino]sulfanylpentyl]isoindol-1-one;ethane |
| SMILES | CC.CCCOc1cc([C@H](C)NSCCCCCN2C(=O)c3ccccc3C2=C2CCC2)ccc1F |
| InChI | InChI=1S/C28H35FN2O2S.C2H6/c1-3-17-33-26-19-22(14-15-25(26)29)20(2)30-34-18-8-4-7-16-31-27(21-10-9-11-21)23-12-5-6-13-24(23)28(31)32;1-2/h5-6,12-15,19-20,30H,3-4,7-11,16-18H2,1-2H3;1-2H3/t20-;/m0./s1 |
| InChIKey | PEKJSETYZDHIEZ-BDQAORGHSA-N |
| XLogP | 8.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|