C23H33FN2O3S — CID 145227308
3-[6-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylhexyl]piperidine-2,6-dione (PubChem CID 145227308) has the molecular formula C23H33FN2O3S and a molecular weight of 436.59 g/mol. Its IUPAC name is 3-[6-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylhexyl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylhexyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 145227308 |
| Molecular Formula | C23H33FN2O3S |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 3-[6-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylhexyl]piperidine-2,6-dione |
| SMILES | CC(NSCCCCCCC1CCC(=O)NC1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C23H33FN2O3S/c1-16(19-9-11-20(24)21(14-19)29-15-17-7-8-17)26-30-13-5-3-2-4-6-18-10-12-22(27)25-23(18)28/h9,11,14,16-18,26H,2-8,10,12-13,15H2,1H3,(H,25,27,28) |
| InChIKey | OWZINSYCUROZAB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|