C24H33FN2O3 — CID 134553801
3-[(Z)-7-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]amino]hept-2-enyl]piperidine-2,6-dione (PubChem CID 134553801) has the molecular formula C24H33FN2O3 and a molecular weight of 416.54 g/mol. Its IUPAC name is 3-[(Z)-7-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]amino]hept-2-enyl]piperidine-2,6-dione.
| Compound Name | 3-[(Z)-7-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]amino]hept-2-enyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 134553801 |
| Molecular Formula | C24H33FN2O3 |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 3-[(Z)-7-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]amino]hept-2-enyl]piperidine-2,6-dione |
| SMILES | C[C@@H](NCCCC/C=C\CC1CCC(=O)NC1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C24H33FN2O3/c1-17(20-10-12-21(25)22(15-20)30-16-18-8-9-18)26-14-6-4-2-3-5-7-19-11-13-23(28)27-24(19)29/h3,5,10,12,15,17-19,26H,2,4,6-9,11,13-14,16H2,1H3,(H,27,28,29)/b5-3-/t17-,19?/m1/s1 |
| InChIKey | TVTOXSUMFPEKTF-WCBSCDNCSA-N |
| XLogP | 4.43 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|