C23H28FN5O3 — CID 134553849
1-[6-[4-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]amino]butyl]pyridazin-3-yl]imidazolidine-2,4-dione (PubChem CID 134553849) has the molecular formula C23H28FN5O3 and a molecular weight of 441.51 g/mol. Its IUPAC name is 1-[6-[4-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]amino]butyl]pyridazin-3-yl]imidazolidine-2,4-dione.
| Compound Name | 1-[6-[4-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]amino]butyl]pyridazin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 134553849 |
| Molecular Formula | C23H28FN5O3 |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 1-[6-[4-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]amino]butyl]pyridazin-3-yl]imidazolidine-2,4-dione |
| SMILES | C[C@@H](NCCCCc1ccc(N2CC(=O)NC2=O)nn1)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C23H28FN5O3/c1-15(17-7-9-19(24)20(12-17)32-14-16-5-6-16)25-11-3-2-4-18-8-10-21(28-27-18)29-13-22(30)26-23(29)31/h7-10,12,15-16,25H,2-6,11,13-14H2,1H3,(H,26,30,31)/t15-/m1/s1 |
| InChIKey | XCADGGTUFXATHX-OAHLLOKOSA-N |
| XLogP | 3.13 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|