C23H28FN5O2S — CID 134553564
1-[2-[4-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]amino]butyl]pyrimidin-4-yl]-4-sulfanylideneimidazolidin-2-one (PubChem CID 134553564) has the molecular formula C23H28FN5O2S and a molecular weight of 457.58 g/mol. Its IUPAC name is 1-[2-[4-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]amino]butyl]pyrimidin-4-yl]-4-sulfanylideneimidazolidin-2-one.
| Compound Name | 1-[2-[4-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]amino]butyl]pyrimidin-4-yl]-4-sulfanylideneimidazolidin-2-one |
|---|---|
| PubChem CID | 134553564 |
| Molecular Formula | C23H28FN5O2S |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 1-[2-[4-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]amino]butyl]pyrimidin-4-yl]-4-sulfanylideneimidazolidin-2-one |
| SMILES | C[C@@H](NCCCCc1nccc(N2CC(=S)NC2=O)n1)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C23H28FN5O2S/c1-15(17-7-8-18(24)19(12-17)31-14-16-5-6-16)25-10-3-2-4-20-26-11-9-21(27-20)29-13-22(32)28-23(29)30/h7-9,11-12,15-16,25H,2-6,10,13-14H2,1H3,(H,28,30,32)/t15-/m1/s1 |
| InChIKey | UOTYBJXOUJWJDR-OAHLLOKOSA-N |
| XLogP | 3.93 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|