C23H30FNO5S — CID 152958004
3-[(Z)-5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpent-2-enyl]piperidine-2,6-dione (PubChem CID 152958004) has the molecular formula C23H30FNO5S and a molecular weight of 451.56 g/mol. Its IUPAC name is 3-[(Z)-5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpent-2-enyl]piperidine-2,6-dione.
| Compound Name | 3-[(Z)-5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpent-2-enyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 152958004 |
| Molecular Formula | C23H30FNO5S |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 3-[(Z)-5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpent-2-enyl]piperidine-2,6-dione |
| SMILES | C[C@@H](CS(=O)(=O)CC/C=C\CC1CCC(=O)NC1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C23H30FNO5S/c1-16(19-8-10-20(24)21(13-19)30-14-17-6-7-17)15-31(28,29)12-4-2-3-5-18-9-11-22(26)25-23(18)27/h2-3,8,10,13,16-18H,4-7,9,11-12,14-15H2,1H3,(H,25,26,27)/b3-2-/t16-,18?/m0/s1 |
| InChIKey | UPZYVGWRRIOGOD-MAHYVNHPSA-N |
| XLogP | 3.52 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|