C25H33FN2O3 — CID 134553665
3-[(E)-7-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]amino]hept-2-enyl]piperidine-2,6-dione (PubChem CID 134553665) has the molecular formula C25H33FN2O3 and a molecular weight of 428.55 g/mol. Its IUPAC name is 3-[(E)-7-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]amino]hept-2-enyl]piperidine-2,6-dione.
| Compound Name | 3-[(E)-7-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]amino]hept-2-enyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 134553665 |
| Molecular Formula | C25H33FN2O3 |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 3-[(E)-7-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]amino]hept-2-enyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(C/C=C/CCCCNC2(c3ccc(F)c(OCC4CC4)c3)CC2)C(=O)N1 |
| InChI | InChI=1S/C25H33FN2O3/c26-21-11-10-20(16-22(21)31-17-18-7-8-18)25(13-14-25)27-15-5-3-1-2-4-6-19-9-12-23(29)28-24(19)30/h2,4,10-11,16,18-19,27H,1,3,5-9,12-15,17H2,(H,28,29,30)/b4-2+ |
| InChIKey | WUNVHTGMJKQHHU-DUXPYHPUSA-N |
| XLogP | 4.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|