C23H34FN3O3 — CID 142360550
3-[5-[2-[1-[4-fluoro-3-(2-methylpropoxy)phenyl]cyclopropyl]hydrazinyl]pentyl]piperidine-2,6-dione (PubChem CID 142360550) has the molecular formula C23H34FN3O3 and a molecular weight of 419.54 g/mol. Its IUPAC name is 3-[5-[2-[1-[4-fluoro-3-(2-methylpropoxy)phenyl]cyclopropyl]hydrazinyl]pentyl]piperidine-2,6-dione.
| Compound Name | 3-[5-[2-[1-[4-fluoro-3-(2-methylpropoxy)phenyl]cyclopropyl]hydrazinyl]pentyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 142360550 |
| Molecular Formula | C23H34FN3O3 |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 3-[5-[2-[1-[4-fluoro-3-(2-methylpropoxy)phenyl]cyclopropyl]hydrazinyl]pentyl]piperidine-2,6-dione |
| SMILES | CC(C)COc1cc(C2(NNCCCCCC3CCC(=O)NC3=O)CC2)ccc1F |
| InChI | InChI=1S/C23H34FN3O3/c1-16(2)15-30-20-14-18(8-9-19(20)24)23(11-12-23)27-25-13-5-3-4-6-17-7-10-21(28)26-22(17)29/h8-9,14,16-17,25,27H,3-7,10-13,15H2,1-2H3,(H,26,28,29) |
| InChIKey | UZCXVWSBAVNCNZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|