C24H31FN2O5S — CID 146228099
(E)-N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-6-(2,6-dioxopiperidin-3-yl)hex-2-ene-1-sulfonamide (PubChem CID 146228099) has the molecular formula C24H31FN2O5S and a molecular weight of 478.59 g/mol. Its IUPAC name is (E)-N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-6-(2,6-dioxopiperidin-3-yl)hex-2-ene-1-sulfonamide.
| Compound Name | (E)-N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-6-(2,6-dioxopiperidin-3-yl)hex-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 146228099 |
| Molecular Formula | C24H31FN2O5S |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | (E)-N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-6-(2,6-dioxopiperidin-3-yl)hex-2-ene-1-sulfonamide |
| SMILES | O=C1CCC(CCC/C=C/CS(=O)(=O)NC2(c3ccc(F)c(OCC4CC4)c3)CC2)C(=O)N1 |
| InChI | InChI=1S/C24H31FN2O5S/c25-20-10-9-19(15-21(20)32-16-17-6-7-17)24(12-13-24)27-33(30,31)14-4-2-1-3-5-18-8-11-22(28)26-23(18)29/h2,4,9-10,15,17-18,27H,1,3,5-8,11-14,16H2,(H,26,28,29)/b4-2+ |
| InChIKey | TYWHCZXWZYQMHC-DUXPYHPUSA-N |
| XLogP | 3.30 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|