C25H34FN3O5S — CID 162462714
(E)-N-[1-[3-(cycloheptylmethoxy)-4-fluorophenyl]cyclopropyl]-5-(2,4-dioxoimidazolidin-1-yl)pent-3-ene-1-sulfonamide (PubChem CID 162462714) has the molecular formula C25H34FN3O5S and a molecular weight of 507.63 g/mol. Its IUPAC name is (E)-N-[1-[3-(cycloheptylmethoxy)-4-fluorophenyl]cyclopropyl]-5-(2,4-dioxoimidazolidin-1-yl)pent-3-ene-1-sulfonamide.
| Compound Name | (E)-N-[1-[3-(cycloheptylmethoxy)-4-fluorophenyl]cyclopropyl]-5-(2,4-dioxoimidazolidin-1-yl)pent-3-ene-1-sulfonamide |
|---|---|
| PubChem CID | 162462714 |
| Molecular Formula | C25H34FN3O5S |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | (E)-N-[1-[3-(cycloheptylmethoxy)-4-fluorophenyl]cyclopropyl]-5-(2,4-dioxoimidazolidin-1-yl)pent-3-ene-1-sulfonamide |
| SMILES | O=C1CN(C/C=C/CCS(=O)(=O)NC2(c3ccc(F)c(OCC4CCCCCC4)c3)CC2)C(=O)N1 |
| InChI | InChI=1S/C25H34FN3O5S/c26-21-11-10-20(16-22(21)34-18-19-8-4-1-2-5-9-19)25(12-13-25)28-35(32,33)15-7-3-6-14-29-17-23(30)27-24(29)31/h3,6,10-11,16,19,28H,1-2,4-5,7-9,12-15,17-18H2,(H,27,30,31)/b6-3+ |
| InChIKey | FXRYCUDQEAKQFX-ZZXKWVIFSA-N |
| XLogP | 3.58 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|