C20H26FN3O5S — CID 134543766
3-(cyclopropylmethoxy)-N-[(E)-6-(2,4-dioxo-1,3-diazinan-1-yl)hex-4-enyl]-4-fluorobenzenesulfonamide (PubChem CID 134543766) has the molecular formula C20H26FN3O5S and a molecular weight of 439.51 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-N-[(E)-6-(2,4-dioxo-1,3-diazinan-1-yl)hex-4-enyl]-4-fluorobenzenesulfonamide.
| Compound Name | 3-(cyclopropylmethoxy)-N-[(E)-6-(2,4-dioxo-1,3-diazinan-1-yl)hex-4-enyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 134543766 |
| Molecular Formula | C20H26FN3O5S |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 3-(cyclopropylmethoxy)-N-[(E)-6-(2,4-dioxo-1,3-diazinan-1-yl)hex-4-enyl]-4-fluorobenzenesulfonamide |
| SMILES | O=C1CCN(C/C=C/CCCNS(=O)(=O)c2ccc(F)c(OCC3CC3)c2)C(=O)N1 |
| InChI | InChI=1S/C20H26FN3O5S/c21-17-8-7-16(13-18(17)29-14-15-5-6-15)30(27,28)22-10-3-1-2-4-11-24-12-9-19(25)23-20(24)26/h2,4,7-8,13,15,22H,1,3,5-6,9-12,14H2,(H,23,25,26)/b4-2+ |
| InChIKey | RVRUQSVQQXZKLR-DUXPYHPUSA-N |
| XLogP | 2.17 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|