C19H28FNO3S — CID 155206581
3-(cyclopropylmethoxy)-4-fluoro-N-[(E)-2-methyloct-3-en-2-yl]benzenesulfonamide (PubChem CID 155206581) has the molecular formula C19H28FNO3S and a molecular weight of 369.50 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-4-fluoro-N-[(E)-2-methyloct-3-en-2-yl]benzenesulfonamide.
| Compound Name | 3-(cyclopropylmethoxy)-4-fluoro-N-[(E)-2-methyloct-3-en-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 155206581 |
| Molecular Formula | C19H28FNO3S |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 3-(cyclopropylmethoxy)-4-fluoro-N-[(E)-2-methyloct-3-en-2-yl]benzenesulfonamide |
| SMILES | CCCC/C=C/C(C)(C)NS(=O)(=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C19H28FNO3S/c1-4-5-6-7-12-19(2,3)21-25(22,23)16-10-11-17(20)18(13-16)24-14-15-8-9-15/h7,10-13,15,21H,4-6,8-9,14H2,1-3H3/b12-7+ |
| InChIKey | RWOQWQDZZJPLOD-KPKJPENVSA-N |
| XLogP | 4.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|