C21H32FNO3S — CID 146352879
(E)-N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-6,6-dimethylhept-2-ene-1-sulfonamide (PubChem CID 146352879) has the molecular formula C21H32FNO3S and a molecular weight of 397.56 g/mol. Its IUPAC name is (E)-N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-6,6-dimethylhept-2-ene-1-sulfonamide.
| Compound Name | (E)-N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-6,6-dimethylhept-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 146352879 |
| Molecular Formula | C21H32FNO3S |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | (E)-N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-6,6-dimethylhept-2-ene-1-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)C/C=C/CCC(C)(C)C)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C21H32FNO3S/c1-16(23-27(24,25)13-7-5-6-12-21(2,3)4)18-10-11-19(22)20(14-18)26-15-17-8-9-17/h5,7,10-11,14,16-17,23H,6,8-9,12-13,15H2,1-4H3/b7-5+/t16-/m1/s1 |
| InChIKey | ASVNMFLXGFZXII-BIENSFFJSA-N |
| XLogP | 4.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|