C18H25F3O — CID 15250368
1,2,4-trifluoro-5-[(4-pentylcyclohexyl)methoxy]benzene (PubChem CID 15250368) has the molecular formula C18H25F3O and a molecular weight of 314.39 g/mol. Its IUPAC name is 1,2,4-trifluoro-5-[(4-pentylcyclohexyl)methoxy]benzene.
| Compound Name | 1,2,4-trifluoro-5-[(4-pentylcyclohexyl)methoxy]benzene |
|---|---|
| PubChem CID | 15250368 |
| Molecular Formula | C18H25F3O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 1,2,4-trifluoro-5-[(4-pentylcyclohexyl)methoxy]benzene |
| SMILES | CCCCCC1CCC(COc2cc(F)c(F)cc2F)CC1 |
| InChI | InChI=1S/C18H25F3O/c1-2-3-4-5-13-6-8-14(9-7-13)12-22-18-11-16(20)15(19)10-17(18)21/h10-11,13-14H,2-9,12H2,1H3 |
| InChIKey | QIPWXYSJSTVCKK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|