C17H24F2O — CID 67806514
1-[(4-butylcyclohexyl)methoxy]-2,4-difluorobenzene (PubChem CID 67806514) has the molecular formula C17H24F2O and a molecular weight of 282.37 g/mol. Its IUPAC name is 1-[(4-butylcyclohexyl)methoxy]-2,4-difluorobenzene.
| Compound Name | 1-[(4-butylcyclohexyl)methoxy]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 67806514 |
| Molecular Formula | C17H24F2O |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1-[(4-butylcyclohexyl)methoxy]-2,4-difluorobenzene |
| SMILES | CCCCC1CCC(COc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C17H24F2O/c1-2-3-4-13-5-7-14(8-6-13)12-20-17-10-9-15(18)11-16(17)19/h9-11,13-14H,2-8,12H2,1H3 |
| InChIKey | IZDVIHAWISQVIW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |