C10H14F2O — CID 142043713
ethane;1-ethoxy-2,4-difluorobenzene (PubChem CID 142043713) has the molecular formula C10H14F2O and a molecular weight of 188.22 g/mol. Its IUPAC name is ethane;1-ethoxy-2,4-difluorobenzene.
| Compound Name | ethane;1-ethoxy-2,4-difluorobenzene |
|---|---|
| PubChem CID | 142043713 |
| Molecular Formula | C10H14F2O |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | ethane;1-ethoxy-2,4-difluorobenzene |
| SMILES | CC.CCOc1ccc(F)cc1F |
| InChI | InChI=1S/C8H8F2O.C2H6/c1-2-11-8-4-3-6(9)5-7(8)10;1-2/h3-5H,2H2,1H3;1-2H3 |
| InChIKey | VACRITZIVPGKPR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |