C7H5BF5O- — CID 63702065
(2,4-difluorophenoxy)methyl-trifluoroboranuide (PubChem CID 63702065) has the molecular formula C7H5BF5O- and a molecular weight of 210.92 g/mol. Its IUPAC name is (2,4-difluorophenoxy)methyl-trifluoroboranuide.
| Compound Name | (2,4-difluorophenoxy)methyl-trifluoroboranuide |
|---|---|
| PubChem CID | 63702065 |
| Molecular Formula | C7H5BF5O- |
| Molecular Weight | 210.92 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | (2,4-difluorophenoxy)methyl-trifluoroboranuide |
| SMILES | Fc1ccc(OC[B-](F)(F)F)c(F)c1 |
| InChI | InChI=1S/C7H5BF5O/c9-5-1-2-7(6(10)3-5)14-4-8(11,12)13/h1-3H,4H2/q-1 |
| InChIKey | HASLIZFDABPFJK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.92 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|