C8H8F2OS — CID 79002379
2-(2,4-difluorophenoxy)ethanethiol (PubChem CID 79002379) has the molecular formula C8H8F2OS and a molecular weight of 190.21 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)ethanethiol.
| Compound Name | 2-(2,4-difluorophenoxy)ethanethiol |
|---|---|
| PubChem CID | 79002379 |
| Molecular Formula | C8H8F2OS |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 2-(2,4-difluorophenoxy)ethanethiol |
| SMILES | Fc1ccc(OCCS)c(F)c1 |
| InChI | InChI=1S/C8H8F2OS/c9-6-1-2-8(7(10)5-6)11-3-4-12/h1-2,5,12H,3-4H2 |
| InChIKey | VSHBXFHXUMGOFF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|