C11H11F2NO — CID 60772052
5-(2,4-difluorophenoxy)pentanenitrile (PubChem CID 60772052) has the molecular formula C11H11F2NO and a molecular weight of 211.21 g/mol. Its IUPAC name is 5-(2,4-difluorophenoxy)pentanenitrile.
| Compound Name | 5-(2,4-difluorophenoxy)pentanenitrile |
|---|---|
| PubChem CID | 60772052 |
| Molecular Formula | C11H11F2NO |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 5-(2,4-difluorophenoxy)pentanenitrile |
| SMILES | N#CCCCCOc1ccc(F)cc1F |
| InChI | InChI=1S/C11H11F2NO/c12-9-4-5-11(10(13)8-9)15-7-3-1-2-6-14/h4-5,8H,1-3,7H2 |
| InChIKey | PKYSJJGDFUNACQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|