C10H8BrF2NO — CID 91655399
4-(4-bromo-2,5-difluorophenoxy)butanenitrile (PubChem CID 91655399) has the molecular formula C10H8BrF2NO and a molecular weight of 276.08 g/mol. Its IUPAC name is 4-(4-bromo-2,5-difluorophenoxy)butanenitrile.
| Compound Name | 4-(4-bromo-2,5-difluorophenoxy)butanenitrile |
|---|---|
| PubChem CID | 91655399 |
| Molecular Formula | C10H8BrF2NO |
| Molecular Weight | 276.08 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | 4-(4-bromo-2,5-difluorophenoxy)butanenitrile |
| SMILES | N#CCCCOc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C10H8BrF2NO/c11-7-5-9(13)10(6-8(7)12)15-4-2-1-3-14/h5-6H,1-2,4H2 |
| InChIKey | IJJIHNWMGBYTCU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.08 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|