C10H9BrF2N2 — CID 65467644
4-(4-bromo-2,6-difluoroanilino)butanenitrile (PubChem CID 65467644) has the molecular formula C10H9BrF2N2 and a molecular weight of 275.10 g/mol. Its IUPAC name is 4-(4-bromo-2,6-difluoroanilino)butanenitrile.
| Compound Name | 4-(4-bromo-2,6-difluoroanilino)butanenitrile |
|---|---|
| PubChem CID | 65467644 |
| Molecular Formula | C10H9BrF2N2 |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 4-(4-bromo-2,6-difluoroanilino)butanenitrile |
| SMILES | N#CCCCNc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C10H9BrF2N2/c11-7-5-8(12)10(9(13)6-7)15-4-2-1-3-14/h5-6,15H,1-2,4H2 |
| InChIKey | XJUQEZFMHZSMPD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|