C9H7ClF2N2 — CID 83081189
3-(2-chloro-4,6-difluoroanilino)propanenitrile (PubChem CID 83081189) has the molecular formula C9H7ClF2N2 and a molecular weight of 216.62 g/mol. Its IUPAC name is 3-(2-chloro-4,6-difluoroanilino)propanenitrile.
| Compound Name | 3-(2-chloro-4,6-difluoroanilino)propanenitrile |
|---|---|
| PubChem CID | 83081189 |
| Molecular Formula | C9H7ClF2N2 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 3-(2-chloro-4,6-difluoroanilino)propanenitrile |
| SMILES | N#CCCNc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C9H7ClF2N2/c10-7-4-6(11)5-8(12)9(7)14-3-1-2-13/h4-5,14H,1,3H2 |
| InChIKey | NLQGLFGRCPGJKL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|