C10H12ClF2NO — CID 83081105
4-(2-chloro-4,6-difluoroanilino)butan-1-ol (PubChem CID 83081105) has the molecular formula C10H12ClF2NO and a molecular weight of 235.66 g/mol. Its IUPAC name is 4-(2-chloro-4,6-difluoroanilino)butan-1-ol.
| Compound Name | 4-(2-chloro-4,6-difluoroanilino)butan-1-ol |
|---|---|
| PubChem CID | 83081105 |
| Molecular Formula | C10H12ClF2NO |
| Molecular Weight | 235.66 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 4-(2-chloro-4,6-difluoroanilino)butan-1-ol |
| SMILES | OCCCCNc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C10H12ClF2NO/c11-8-5-7(12)6-9(13)10(8)14-3-1-2-4-15/h5-6,14-15H,1-4H2 |
| InChIKey | NNWJIKFDCIASRW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.66 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|