C10H10Cl2FNO2 — CID 83082072
N-(2,6-dichloro-4-fluorophenyl)-4-hydroxybutanamide (PubChem CID 83082072) has the molecular formula C10H10Cl2FNO2 and a molecular weight of 266.10 g/mol. Its IUPAC name is N-(2,6-dichloro-4-fluorophenyl)-4-hydroxybutanamide.
| Compound Name | N-(2,6-dichloro-4-fluorophenyl)-4-hydroxybutanamide |
|---|---|
| PubChem CID | 83082072 |
| Molecular Formula | C10H10Cl2FNO2 |
| Molecular Weight | 266.10 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | N-(2,6-dichloro-4-fluorophenyl)-4-hydroxybutanamide |
| SMILES | O=C(CCCO)Nc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C10H10Cl2FNO2/c11-7-4-6(13)5-8(12)10(7)14-9(16)2-1-3-15/h4-5,15H,1-3H2,(H,14,16) |
| InChIKey | GXQQBBXWCYRPSG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.10 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |