C14H10Cl2FNOS — CID 107033961
N-(2,6-dichloro-4-fluorophenyl)-2-(4-sulfanylphenyl)acetamide (PubChem CID 107033961) has the molecular formula C14H10Cl2FNOS and a molecular weight of 330.21 g/mol. Its IUPAC name is N-(2,6-dichloro-4-fluorophenyl)-2-(4-sulfanylphenyl)acetamide.
| Compound Name | N-(2,6-dichloro-4-fluorophenyl)-2-(4-sulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 107033961 |
| Molecular Formula | C14H10Cl2FNOS |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | N-(2,6-dichloro-4-fluorophenyl)-2-(4-sulfanylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(S)cc1)Nc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C14H10Cl2FNOS/c15-11-6-9(17)7-12(16)14(11)18-13(19)5-8-1-3-10(20)4-2-8/h1-4,6-7,20H,5H2,(H,18,19) |
| InChIKey | AKEKVGVQWRAXPV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|