C11H11BrCl3NO — CID 103601704
5-bromo-N-(2,4,6-trichlorophenyl)pentanamide (PubChem CID 103601704) has the molecular formula C11H11BrCl3NO and a molecular weight of 359.48 g/mol. Its IUPAC name is 5-bromo-N-(2,4,6-trichlorophenyl)pentanamide.
| Compound Name | 5-bromo-N-(2,4,6-trichlorophenyl)pentanamide |
|---|---|
| PubChem CID | 103601704 |
| Molecular Formula | C11H11BrCl3NO |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 356.91 |
| IUPAC Name | 5-bromo-N-(2,4,6-trichlorophenyl)pentanamide |
| SMILES | O=C(CCCCBr)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11BrCl3NO/c12-4-2-1-3-10(17)16-11-8(14)5-7(13)6-9(11)15/h5-6H,1-4H2,(H,16,17) |
| InChIKey | JTIALEMPIPOSKG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|