C10H9BrCl3NO — CID 71446010
4-bromo-N-(3,4,5-trichlorophenyl)butanamide (PubChem CID 71446010) has the molecular formula C10H9BrCl3NO and a molecular weight of 345.45 g/mol. Its IUPAC name is 4-bromo-N-(3,4,5-trichlorophenyl)butanamide.
| Compound Name | 4-bromo-N-(3,4,5-trichlorophenyl)butanamide |
|---|---|
| PubChem CID | 71446010 |
| Molecular Formula | C10H9BrCl3NO |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 342.89 |
| IUPAC Name | 4-bromo-N-(3,4,5-trichlorophenyl)butanamide |
| SMILES | O=C(CCCBr)Nc1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H9BrCl3NO/c11-3-1-2-9(16)15-6-4-7(12)10(14)8(13)5-6/h4-5H,1-3H2,(H,15,16) |
| InChIKey | RMPFJXGCGMKMPJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|