C9H8BrCl2NO — CID 112698581
3-bromo-N-(3,5-dichlorophenyl)propanamide (PubChem CID 112698581) has the molecular formula C9H8BrCl2NO and a molecular weight of 296.98 g/mol. Its IUPAC name is 3-bromo-N-(3,5-dichlorophenyl)propanamide.
| Compound Name | 3-bromo-N-(3,5-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 112698581 |
| Molecular Formula | C9H8BrCl2NO |
| Molecular Weight | 296.98 g/mol |
| Exact Mass | 294.92 |
| IUPAC Name | 3-bromo-N-(3,5-dichlorophenyl)propanamide |
| SMILES | O=C(CCBr)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H8BrCl2NO/c10-2-1-9(14)13-8-4-6(11)3-7(12)5-8/h3-5H,1-2H2,(H,13,14) |
| InChIKey | PTRHMBCCZDOOBE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.98 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|