C11H12Cl2N2O3 — CID 881207
5-(4-amino-3,5-dichloroanilino)-5-oxopentanoic acid (PubChem CID 881207) has the molecular formula C11H12Cl2N2O3 and a molecular weight of 291.13 g/mol. Its IUPAC name is 5-(4-amino-3,5-dichloroanilino)-5-oxopentanoic acid.
| Compound Name | 5-(4-amino-3,5-dichloroanilino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 881207 |
| Molecular Formula | C11H12Cl2N2O3 |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 5-(4-amino-3,5-dichloroanilino)-5-oxopentanoic acid |
| SMILES | Nc1c(Cl)cc(NC(=O)CCCC(=O)O)cc1Cl |
| InChI | InChI=1S/C11H12Cl2N2O3/c12-7-4-6(5-8(13)11(7)14)15-9(16)2-1-3-10(17)18/h4-5H,1-3,14H2,(H,15,16)(H,17,18) |
| InChIKey | AVBWWNNKDXSVKH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|