C17H16Cl2FN3O2 — CID 60572410
N-[4-(4-amino-3,5-dichloroanilino)-4-oxobutyl]-4-fluorobenzamide (PubChem CID 60572410) has the molecular formula C17H16Cl2FN3O2 and a molecular weight of 384.24 g/mol. Its IUPAC name is N-[4-(4-amino-3,5-dichloroanilino)-4-oxobutyl]-4-fluorobenzamide.
| Compound Name | N-[4-(4-amino-3,5-dichloroanilino)-4-oxobutyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 60572410 |
| Molecular Formula | C17H16Cl2FN3O2 |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | N-[4-(4-amino-3,5-dichloroanilino)-4-oxobutyl]-4-fluorobenzamide |
| SMILES | Nc1c(Cl)cc(NC(=O)CCCNC(=O)c2ccc(F)cc2)cc1Cl |
| InChI | InChI=1S/C17H16Cl2FN3O2/c18-13-8-12(9-14(19)16(13)21)23-15(24)2-1-7-22-17(25)10-3-5-11(20)6-4-10/h3-6,8-9H,1-2,7,21H2,(H,22,25)(H,23,24) |
| InChIKey | JYLVWYHXBGIHHJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|