C14H16Cl2N4O3 — CID 18208015
N-(4-amino-3,5-dichlorophenyl)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide (PubChem CID 18208015) has the molecular formula C14H16Cl2N4O3 and a molecular weight of 359.21 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 18208015 |
| Molecular Formula | C14H16Cl2N4O3 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
| SMILES | CN1CC(=O)N(CCCC(=O)Nc2cc(Cl)c(N)c(Cl)c2)C1=O |
| InChI | InChI=1S/C14H16Cl2N4O3/c1-19-7-12(22)20(14(19)23)4-2-3-11(21)18-8-5-9(15)13(17)10(16)6-8/h5-6H,2-4,7,17H2,1H3,(H,18,21) |
| InChIKey | UWJQYPQLYZHWKP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|