C19H23N3O5 — CID 17420767
4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbutanamide (PubChem CID 17420767) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbutanamide.
| Compound Name | 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbutanamide |
|---|---|
| PubChem CID | 17420767 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbutanamide |
| SMILES | CN1CC(=O)N(CCCC(=O)Nc2ccc3c(c2)OC2(CCCC2)O3)C1=O |
| InChI | InChI=1S/C19H23N3O5/c1-21-12-17(24)22(18(21)25)10-4-5-16(23)20-13-6-7-14-15(11-13)27-19(26-14)8-2-3-9-19/h6-7,11H,2-5,8-10,12H2,1H3,(H,20,23) |
| InChIKey | JNSQKEDEJVKNLE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|