C23H26N2O4 — CID 46664862
N-[4-oxo-4-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)butyl]benzamide (PubChem CID 46664862) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is N-[4-oxo-4-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)butyl]benzamide.
| Compound Name | N-[4-oxo-4-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)butyl]benzamide |
|---|---|
| PubChem CID | 46664862 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-[4-oxo-4-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)butyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccccc1)Nc1ccc2c(c1)OC1(CCCCC1)O2 |
| InChI | InChI=1S/C23H26N2O4/c26-21(10-7-15-24-22(27)17-8-3-1-4-9-17)25-18-11-12-19-20(16-18)29-23(28-19)13-5-2-6-14-23/h1,3-4,8-9,11-12,16H,2,5-7,10,13-15H2,(H,24,27)(H,25,26) |
| InChIKey | MLQIMSFWYSFNFW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|