C17H22N2O5 — CID 122075122
4-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylcarbamoylamino)butanoic acid (PubChem CID 122075122) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is 4-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylcarbamoylamino)butanoic acid.
| Compound Name | 4-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 122075122 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 4-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylcarbamoylamino)butanoic acid |
| SMILES | O=C(O)CCCNC(=O)Nc1ccc2c(c1)OC1(CCCCC1)O2 |
| InChI | InChI=1S/C17H22N2O5/c20-15(21)5-4-10-18-16(22)19-12-6-7-13-14(11-12)24-17(23-13)8-2-1-3-9-17/h6-7,11H,1-5,8-10H2,(H,20,21)(H2,18,19,22) |
| InChIKey | CFOFUHKNHARJAI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|