C20H22N2O4S — CID 42280483
N-[4-oxo-4-(spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylamino)butyl]thiophene-2-carboxamide (PubChem CID 42280483) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is N-[4-oxo-4-(spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylamino)butyl]thiophene-2-carboxamide.
| Compound Name | N-[4-oxo-4-(spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylamino)butyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42280483 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-[4-oxo-4-(spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylamino)butyl]thiophene-2-carboxamide |
| SMILES | O=C(CCCNC(=O)c1cccs1)Nc1ccc2c(c1)OC1(CCCC1)O2 |
| InChI | InChI=1S/C20H22N2O4S/c23-18(6-3-11-21-19(24)17-5-4-12-27-17)22-14-7-8-15-16(13-14)26-20(25-15)9-1-2-10-20/h4-5,7-8,12-13H,1-3,6,9-11H2,(H,21,24)(H,22,23) |
| InChIKey | HVHZCVLXIXOJAZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|