C15H19N3O5S — CID 9072319
4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(3-methylsulfonylphenyl)butanamide (PubChem CID 9072319) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(3-methylsulfonylphenyl)butanamide.
| Compound Name | 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(3-methylsulfonylphenyl)butanamide |
|---|---|
| PubChem CID | 9072319 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(3-methylsulfonylphenyl)butanamide |
| SMILES | CN1CC(=O)N(CCCC(=O)Nc2cccc(S(C)(=O)=O)c2)C1=O |
| InChI | InChI=1S/C15H19N3O5S/c1-17-10-14(20)18(15(17)21)8-4-7-13(19)16-11-5-3-6-12(9-11)24(2,22)23/h3,5-6,9H,4,7-8,10H2,1-2H3,(H,16,19) |
| InChIKey | AGQPRSOSEJZPIK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|