C22H25N5O4 — CID 55762912
4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-methyl-5-(phenylcarbamoylamino)phenyl]butanamide (PubChem CID 55762912) has the molecular formula C22H25N5O4 and a molecular weight of 423.47 g/mol. Its IUPAC name is 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-methyl-5-(phenylcarbamoylamino)phenyl]butanamide.
| Compound Name | 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-methyl-5-(phenylcarbamoylamino)phenyl]butanamide |
|---|---|
| PubChem CID | 55762912 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-methyl-5-(phenylcarbamoylamino)phenyl]butanamide |
| SMILES | Cc1ccc(NC(=O)Nc2ccccc2)cc1NC(=O)CCCN1C(=O)CN(C)C1=O |
| InChI | InChI=1S/C22H25N5O4/c1-15-10-11-17(24-21(30)23-16-7-4-3-5-8-16)13-18(15)25-19(28)9-6-12-27-20(29)14-26(2)22(27)31/h3-5,7-8,10-11,13H,6,9,12,14H2,1-2H3,(H,25,28)(H2,23,24,30) |
| InChIKey | BMNRCPXXNJOOQS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|