C21H20N2O4 — CID 110604119
N-(5-acetyl-2-methylphenyl)-4-(1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 110604119) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is N-(5-acetyl-2-methylphenyl)-4-(1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-(5-acetyl-2-methylphenyl)-4-(1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 110604119 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-(5-acetyl-2-methylphenyl)-4-(1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | CC(=O)c1ccc(C)c(NC(=O)CCCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C21H20N2O4/c1-13-9-10-15(14(2)24)12-18(13)22-19(25)8-5-11-23-20(26)16-6-3-4-7-17(16)21(23)27/h3-4,6-7,9-10,12H,5,8,11H2,1-2H3,(H,22,25) |
| InChIKey | URQBEVLZUXASEE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|