C19H16N2O5 — CID 1250549
3-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-methylbenzoic acid (PubChem CID 1250549) has the molecular formula C19H16N2O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is 3-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-methylbenzoic acid.
| Compound Name | 3-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 1250549 |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 3-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1NC(=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H16N2O5/c1-11-6-7-12(19(25)26)10-15(11)20-16(22)8-9-21-17(23)13-4-2-3-5-14(13)18(21)24/h2-7,10H,8-9H2,1H3,(H,20,22)(H,25,26) |
| InChIKey | OEZWVOFDMIEXHV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|