C25H20ClN3O4 — CID 55677974
4-chloro-N-[2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]phenyl]benzamide (PubChem CID 55677974) has the molecular formula C25H20ClN3O4 and a molecular weight of 461.91 g/mol. Its IUPAC name is 4-chloro-N-[2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]phenyl]benzamide.
| Compound Name | 4-chloro-N-[2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 55677974 |
| Molecular Formula | C25H20ClN3O4 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 4-chloro-N-[2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]phenyl]benzamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)Nc1ccccc1NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H20ClN3O4/c26-17-13-11-16(12-14-17)23(31)28-21-9-4-3-8-20(21)27-22(30)10-5-15-29-24(32)18-6-1-2-7-19(18)25(29)33/h1-4,6-9,11-14H,5,10,15H2,(H,27,30)(H,28,31) |
| InChIKey | MFPPGHLOPLRNEK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|