C23H18ClN3O5 — CID 55811982
N-[5-chloro-2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]phenyl]furan-2-carboxamide (PubChem CID 55811982) has the molecular formula C23H18ClN3O5 and a molecular weight of 451.87 g/mol. Its IUPAC name is N-[5-chloro-2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[5-chloro-2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55811982 |
| Molecular Formula | C23H18ClN3O5 |
| Molecular Weight | 451.87 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | N-[5-chloro-2-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]phenyl]furan-2-carboxamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)Nc1ccc(Cl)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C23H18ClN3O5/c24-14-9-10-17(18(13-14)26-21(29)19-7-4-12-32-19)25-20(28)8-3-11-27-22(30)15-5-1-2-6-16(15)23(27)31/h1-2,4-7,9-10,12-13H,3,8,11H2,(H,25,28)(H,26,29) |
| InChIKey | PUDBUCQWFMDGIE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.87 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|