C25H20F3N3O5 — CID 26062392
N-[4-[4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoylamino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 26062392) has the molecular formula C25H20F3N3O5 and a molecular weight of 499.45 g/mol. Its IUPAC name is N-[4-[4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoylamino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoylamino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 26062392 |
| Molecular Formula | C25H20F3N3O5 |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | N-[4-[4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoylamino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)Nc1ccc(NC(=O)c3ccco3)cc1C(F)(F)F)C2=O |
| InChI | InChI=1S/C25H20F3N3O5/c1-14-6-8-16-17(12-14)24(35)31(23(16)34)10-2-5-21(32)30-19-9-7-15(13-18(19)25(26,27)28)29-22(33)20-4-3-11-36-20/h3-4,6-9,11-13H,2,5,10H2,1H3,(H,29,33)(H,30,32) |
| InChIKey | VHCVNBWJNDCIBF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|