C20H14BrF3N2O3 — CID 26062040
N-[4-[[2-(4-bromophenyl)acetyl]amino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 26062040) has the molecular formula C20H14BrF3N2O3 and a molecular weight of 467.24 g/mol. Its IUPAC name is N-[4-[[2-(4-bromophenyl)acetyl]amino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[2-(4-bromophenyl)acetyl]amino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 26062040 |
| Molecular Formula | C20H14BrF3N2O3 |
| Molecular Weight | 467.24 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | N-[4-[[2-(4-bromophenyl)acetyl]amino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Cc1ccc(Br)cc1)Nc1ccc(NC(=O)c2ccco2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H14BrF3N2O3/c21-13-5-3-12(4-6-13)10-18(27)26-16-8-7-14(11-15(16)20(22,23)24)25-19(28)17-2-1-9-29-17/h1-9,11H,10H2,(H,25,28)(H,26,27) |
| InChIKey | OLSWGVUPLUXAHU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.24 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |