C19H12ClF3N2O3 — CID 43041357
N-[4-[(2-chlorobenzoyl)amino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 43041357) has the molecular formula C19H12ClF3N2O3 and a molecular weight of 408.76 g/mol. Its IUPAC name is N-[4-[(2-chlorobenzoyl)amino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[(2-chlorobenzoyl)amino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 43041357 |
| Molecular Formula | C19H12ClF3N2O3 |
| Molecular Weight | 408.76 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | N-[4-[(2-chlorobenzoyl)amino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)c2ccccc2Cl)c(C(F)(F)F)c1)c1ccco1 |
| InChI | InChI=1S/C19H12ClF3N2O3/c20-14-5-2-1-4-12(14)17(26)25-15-8-7-11(10-13(15)19(21,22)23)24-18(27)16-6-3-9-28-16/h1-10H,(H,24,27)(H,25,26) |
| InChIKey | PORBVONGEGXPDN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.76 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |