C21H14BrF3N2O3 — CID 55501031
N-[4-[3-(2-bromophenyl)prop-2-enoylamino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 55501031) has the molecular formula C21H14BrF3N2O3 and a molecular weight of 479.25 g/mol. Its IUPAC name is N-[4-[3-(2-bromophenyl)prop-2-enoylamino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[3-(2-bromophenyl)prop-2-enoylamino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55501031 |
| Molecular Formula | C21H14BrF3N2O3 |
| Molecular Weight | 479.25 g/mol |
| Exact Mass | 478.01 |
| IUPAC Name | N-[4-[3-(2-bromophenyl)prop-2-enoylamino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(C=Cc1ccccc1Br)Nc1ccc(NC(=O)c2ccco2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H14BrF3N2O3/c22-16-5-2-1-4-13(16)7-10-19(28)27-17-9-8-14(12-15(17)21(23,24)25)26-20(29)18-6-3-11-30-18/h1-12H,(H,26,29)(H,27,28) |
| InChIKey | CSZCQKHUUYIFIF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.25 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|